fanniielovee fanniielovee

17-02-2021
History

contestada

Which other methods do countries have to convince or coerce its citizens?

Respuesta :

gamzee0 gamzee0

17-02-2021

Answer:

they can put a gun to their head and convince them

Answer Link

Otras preguntas

B. identify two political factors that affect the confirmation process of a president's nominees and explain how each factor complicates a confirmation.

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

What is the length of the longest side of a triangle that has the vertices (-3,5), (-4,5), and (-4,3)

How is a cow eating grass a part of both carbon and oxygen cycle

A building casts a shadow 49 feet long. at the same time, a 42-foot-tall flagpole casts a shadow of 9.8 feet long. what is the height of the building?

Please tell me rhyme and meter!!!!! I will give brainliest!!!! The Rose That Grew from Concrete By Tupac Shakur Did you hear about the rose that grew from a c

6) DNA and RNA differ in all BUT one of the following ways. A) DNA is double-stranded, while RNA is single stranded. B) RNA uses the sugar ribose in its ba

why are elements grouped together in the same family?

A comedian knows twelve jokes. one joke is old, one joke is new, and the other jokes are somewhere between. if the order in which these jokes are told makes a

According to john robbins in diet for a new america, there is more than enough food to go around, but it's being wasted. how